Difference between revisions of "CPD-10792"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10792 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate |
* smiles: | * smiles: | ||
| − | ** c(c(o)cc( | + | ** cc(=o)c(o)c(o)cc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ifmhgoadxgywmo-kvqbguixsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 191.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10032]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=191.183}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-10792
- common-name:
- 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
- smiles:
- cc(=o)c(o)c(o)cc([n+])c([o-])=o
- inchi-key:
- ifmhgoadxgywmo-kvqbguixsa-n
- molecular-weight:
- 191.183
