Difference between revisions of "CPD-10792"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLCROTONYL-COA-CARBOXYLASE-RXN METHYLCROTONYL-COA-CARBOXYLASE-RXN] == * direction: ** left-to-r...") |
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-10792 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** 3- | + | ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)c(o)c(o)cc([n+])c([o-])=o |
− | = | + | * inchi-key: |
− | + | ** ifmhgoadxgywmo-kvqbguixsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 191.183 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10032]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}} | |
− | + | {{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}} | |
− | + | {{#set: molecular-weight=191.183}} | |
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name=3- | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-10792
- common-name:
- 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
- smiles:
- cc(=o)c(o)c(o)cc([n+])c([o-])=o
- inchi-key:
- ifmhgoadxgywmo-kvqbguixsa-n
- molecular-weight:
- 191.183