Difference between revisions of "CPD-10792"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:pathway | ?common-name | ?nb reaction found | ?nb total reaction | ?completion rate |sort=completion rate, nb total reaction |order=descending }}") |
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite CPD-10792 == | |
− | + | * common-name: | |
− | + | ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate | |
− | + | * smiles: | |
− | + | ** cc(=o)c(o)c(o)cc([n+])c([o-])=o | |
− | + | * inchi-key: | |
− | }} | + | ** ifmhgoadxgywmo-kvqbguixsa-n |
+ | * molecular-weight: | ||
+ | ** 191.183 | ||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10032]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}} | ||
+ | {{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}} | ||
+ | {{#set: molecular-weight=191.183}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-10792
- common-name:
- 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
- smiles:
- cc(=o)c(o)c(o)cc([n+])c([o-])=o
- inchi-key:
- ifmhgoadxgywmo-kvqbguixsa-n
- molecular-weight:
- 191.183