Difference between revisions of "CPD-108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-597 == * common-name: ** n-carbamoylputrescine * smiles: ** c(cccnc(n)=o)[n+] * inchi-key: ** yanfyyganiyhgi-uhfffaoysa-o * molecular...") |
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TYR == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-tyrosine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ouycccasqsfeme-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 181.191 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6.3.2.25-RXN]] |
| + | * [[MONOPHENOL-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-11319]] | ||
| + | * [[RXN-5861]] | ||
| + | * [[TYROSINE--TRNA-LIGASE-RXN]] | ||
| + | * [[TYROSINE-AMINOTRANSFERASE-RXN]] | ||
| + | * [[TYROSINE-DECARBOXYLASE-RXN]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5682]] |
| + | * [[TYROSINE-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-tyrosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ouycccasqsfeme-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=181.191}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite TYR
- common-name:
- l-tyrosine
- smiles:
- c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-]
- inchi-key:
- ouycccasqsfeme-qmmmgpobsa-n
- molecular-weight:
- 181.191
Reaction(s) known to consume the compound
- 6.3.2.25-RXN
- MONOPHENOL-MONOOXYGENASE-RXN
- RXN-11319
- RXN-5861
- TYROSINE--TRNA-LIGASE-RXN
- TYROSINE-AMINOTRANSFERASE-RXN
- TYROSINE-DECARBOXYLASE-RXN
- biomass_rxn
