Difference between revisions of "CPD-108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-108 == * common-name: ** 4-methylphenol * smiles: ** cc1(c=cc(=cc=1)o) * inchi-key: ** iwdclrjobjjrnh-uhfffaoysa-n * molecular-weight...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-108 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylphenol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c=cc(=cc=1)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iwdclrjobjjrnh-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 108.14 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15588]] |
| − | + | == Reaction(s) known to produce the compound == | |
* [[RXN-11319]] | * [[RXN-11319]] | ||
| − | * [[RXN- | + | * [[RXN-15588]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylphenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iwdclrjobjjrnh-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=108.14}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-108
- common-name:
- 4-methylphenol
- smiles:
- cc1(c=cc(=cc=1)o)
- inchi-key:
- iwdclrjobjjrnh-uhfffaoysa-n
- molecular-weight:
- 108.14
