Difference between revisions of "CPD-108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=cco)c=c(oc)c(o)=1) * inchi-key: ** lzfopexouvtgjs-onegzznksa...") |
(Created page with "Category:metabolite == Metabolite CPD-108 == * common-name: ** 4-methylphenol * smiles: ** cc1(c=cc(=cc=1)o) * inchi-key: ** iwdclrjobjjrnh-uhfffaoysa-n * molecular-weight...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-108 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-methylphenol |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(c=cc(=cc=1)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** iwdclrjobjjrnh-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 108.14 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15588]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11319]] |
+ | * [[RXN-15588]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-methylphenol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iwdclrjobjjrnh-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=108.14}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-108
- common-name:
- 4-methylphenol
- smiles:
- cc1(c=cc(=cc=1)o)
- inchi-key:
- iwdclrjobjjrnh-uhfffaoysa-n
- molecular-weight:
- 108.14