Difference between revisions of "CPD-108"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13212 == * transcription-direction: ** negative * right-end-position: ** 95433 * left-end-position: ** 80208 * centisome-position: ** 23.267445...")
(Created page with "Category:metabolite == Metabolite CPD-341 == * common-name: ** indole-3-ethanol * smiles: ** c2(=c(cco)c1(c=cc=cc=1n2)) * inchi-key: ** mbbomcvgycrmea-uhfffaoysa-n * molec...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13212 ==
+
== Metabolite CPD-341 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** indole-3-ethanol
−
* right-end-position:
+
* smiles:
−
** 95433
+
** c2(=c(cco)c1(c=cc=cc=1n2))
−
* left-end-position:
+
* inchi-key:
−
** 80208
+
** mbbomcvgycrmea-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 23.267445   
+
** 161.203
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10717]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3.2.1.109-RXN]]
+
{{#set: common-name=indole-3-ethanol}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=mbbomcvgycrmea-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=161.203}}
−
* [[3.2.1.52-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12177]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12178]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12270]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14021]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-16485]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-16512]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6572]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7646]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6827]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7645]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=95433}}
 
−
{{#set: left-end-position=80208}}
 
−
{{#set: centisome-position=23.267445    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:29, 18 December 2020

Metabolite CPD-341

  • common-name:
    • indole-3-ethanol
  • smiles:
    • c2(=c(cco)c1(c=cc=cc=1n2))
  • inchi-key:
    • mbbomcvgycrmea-uhfffaoysa-n
  • molecular-weight:
    • 161.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-108&oldid=45466"