Difference between revisions of "CPD-108"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=cco)c=c(oc)c(o)=1) * inchi-key: ** lzfopexouvtgjs-onegzznksa...")
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPYL-ALCOHOL ==
+
== Metabolite CPD-193 ==
 
* common-name:
 
* common-name:
** sinapyl alcohol
+
** d-myo-inositol (4,5)-bisphosphate
 
* smiles:
 
* smiles:
** coc1(c=c(c=cco)c=c(oc)c(o)=1)
+
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
* inchi-key:
** lzfopexouvtgjs-onegzznksa-n
+
** mckajxmrulsuki-uzaagftcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 210.229
+
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10948]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1125]]
+
* [[RXN-10948]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapyl alcohol}}
+
{{#set: common-name=d-myo-inositol (4,5)-bisphosphate}}
{{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}}
+
{{#set: inchi-key=inchikey=mckajxmrulsuki-uzaagftcsa-j}}
{{#set: molecular-weight=210.229}}
+
{{#set: molecular-weight=336.085}}

Revision as of 15:24, 5 January 2021

Metabolite CPD-193

  • common-name:
    • d-myo-inositol (4,5)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mckajxmrulsuki-uzaagftcsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality