Difference between revisions of "CPD-10806"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-405 == * common-name: ** a phosphatidyl-n-methylethanolamine == Reaction(s) known to consume the compound == * 2.1.1.71-RXN == Re...") |
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c * i...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-126 == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-carotene |
+ | * smiles: | ||
+ | ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** hrqkoyfghjyefs-bxolysjbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 536.882 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1F-151]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-150]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-carotene}} |
+ | {{#set: inchi-key=inchikey=hrqkoyfghjyefs-bxolysjbsa-n}} | ||
+ | {{#set: molecular-weight=536.882}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD1F-126
- common-name:
- γ-carotene
- smiles:
- cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
- inchi-key:
- hrqkoyfghjyefs-bxolysjbsa-n
- molecular-weight:
- 536.882