Difference between revisions of "CPD-10806"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10606 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PSII-RXN ** Category:...")
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE == * common-name: ** 1d-myo-inositol 1-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10606 ==
+
== Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 1d-myo-inositol 1-monophosphate
== Reaction(s) associated ==
+
* smiles:
* [[PSII-RXN]]
+
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** inapmgsxuvuwaf-uotptpdrsa-l
== Pathway(s) associated ==
+
* molecular-weight:
* [[PWY-101]]
+
** 258.121
** '''2''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to consume the compound ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-16261]]
{{#set: nb reaction associated=1}}
+
* [[RXN0-5408]]
{{#set: nb pathway associated=1}}
+
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16261]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=1d-myo-inositol 1-monophosphate}}
 +
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-uotptpdrsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 20:33, 18 December 2020

Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE

  • common-name:
    • 1d-myo-inositol 1-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-uotptpdrsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality