Difference between revisions of "CPD-10809"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13401 == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** xzwxfwbhyrflef-fs...") |
(Created page with "Category:metabolite == Metabolite 3-terminal-unsaturated-sugars == * common-name: ** a 3'-terminal unsaturated sugar == Reaction(s) known to consume the compound == == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-terminal-unsaturated-sugars == |
* common-name: | * common-name: | ||
− | ** | + | ** a 3'-terminal unsaturated sugar |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[4.2.99.18-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 3'-terminal unsaturated sugar}} |
− | |||
− |
Revision as of 08:31, 15 March 2021
Contents
Metabolite 3-terminal-unsaturated-sugars
- common-name:
- a 3'-terminal unsaturated sugar