Difference between revisions of "CPD-10809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151] == * direction: ** reversible * common-name: ** lysophospholipid ricinoloyltra...")
(Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * smiles: ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151] ==
+
== Metabolite CPD-10809 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** lysophospholipid ricinoloyltransferase
+
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 ec-2.3.1.23]
+
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-15364]][c] '''+''' 1 [[Glycerolipids]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17396]][c]
+
** acivvgbvovhfpq-rpdrrwsusa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13643]]
+
** 353.228
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14171]]
−
* Gene: [[SJ09127]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[RXN-10057]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14171]]
−
* Gene: [[SJ22477]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=353.228}}
−
* [[PWY-7618]], ricinoleate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 
−
** '''17''' reactions found over '''22''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=lysophospholipid ricinoloyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.23}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10809

  • common-name:
    • 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
  • smiles:
    • c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • acivvgbvovhfpq-rpdrrwsusa-l
  • molecular-weight:
    • 353.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10809&oldid=139751"