Difference between revisions of "CPD-10809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BUTYRATE--COA-LIGASE-RXN BUTYRATE--COA-LIGASE-RXN] == * direction: ** left-to-right * common-name:...")
 
(Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * smiles: ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BUTYRATE--COA-LIGASE-RXN BUTYRATE--COA-LIGASE-RXN] ==
+
== Metabolite CPD-10809 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** butyrate-coa ligase
+
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.2.1.2 ec-6.2.1.2]
+
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[Fatty-Acids]][c] '''=>''' 1 [[ACYL-COA]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
+
** acivvgbvovhfpq-rpdrrwsusa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16901]]
+
** 353.228
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-14171]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7007]], methyl ketone biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007]
+
* [[RXN-10057]]
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-14171]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
−
* RHEA:
+
{{#set: molecular-weight=353.228}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24337 24337]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00389 R00389]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=butyrate-coa ligase}}
 
−
{{#set: ec-number=ec-6.2.1.2}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10809

  • common-name:
    • 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
  • smiles:
    • c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • acivvgbvovhfpq-rpdrrwsusa-l
  • molecular-weight:
    • 353.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10809&oldid=139751"