Difference between revisions of "CPD-10814"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...") |
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10814 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-proline |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kznqnbzmbzjqjo-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 172.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6988]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-proline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=172.183}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-10814
- common-name:
- glycyl-l-proline
- smiles:
- c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
- inchi-key:
- kznqnbzmbzjqjo-yfkpbyrvsa-n
- molecular-weight:
- 172.183
