Difference between revisions of "CPD-10818"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4617 == * common-name: ** dihydrozeatin-o-glucoside * smiles: ** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-10818 == * common-name: ** isopentenyl phosphate * smiles: ** c=c(ccop(=o)([o-])[o-])c * inchi-key: ** qmzrxycccyymhf-uhfffaoysa-l *...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-10818 == |
* common-name: | * common-name: | ||
| − | ** | + | ** isopentenyl phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c(ccop(=o)([o-])[o-])c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qmzrxycccyymhf-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 164.097 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10068]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10068]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=isopentenyl phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qmzrxycccyymhf-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.097}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-10818
- common-name:
- isopentenyl phosphate
- smiles:
- c=c(ccop(=o)([o-])[o-])c
- inchi-key:
- qmzrxycccyymhf-uhfffaoysa-l
- molecular-weight:
- 164.097
