Difference between revisions of "CPD-1083"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Negatively-super-coiled-DNAs == * common-name: ** a negatively supercoiled dna == Reaction(s) known to consume the compound == * 5.99.1...")
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Negatively-super-coiled-DNAs ==
+
== Metabolite CPD-1083 ==
 
* common-name:
 
* common-name:
** a negatively supercoiled dna
+
** (e)-2-methylcrotonoyl-coa
 +
* smiles:
 +
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** pmwatmxoqqznbx-dkbzllmosa-j
 +
* molecular-weight:
 +
** 845.604
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[5.99.1.2-RXN]]
+
* [[2-MEBUCOA-FAD-RXN]]
* [[5.99.1.3-RXN]]
+
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
 +
* [[RXN-14266]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.99.1.2-RXN]]
+
* [[2-MEBUCOA-FAD-RXN]]
* [[5.99.1.3-RXN]]
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 +
* [[RXN-14266]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a negatively supercoiled dna}}
+
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
 +
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
 +
{{#set: molecular-weight=845.604}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-1083

  • common-name:
    • (e)-2-methylcrotonoyl-coa
  • smiles:
    • cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • pmwatmxoqqznbx-dkbzllmosa-j
  • molecular-weight:
    • 845.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality