Difference between revisions of "CPD-1083"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05824 == * transcription-direction: ** negative * right-end-position: ** 196004 * left-end-position: ** 186817 * centisome-position: ** 38.431328...")
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05824 ==
+
== Metabolite CPD-1083 ==
* transcription-direction:
+
* common-name:
** negative
+
** (e)-2-methylcrotonoyl-coa
* right-end-position:
+
* smiles:
** 196004
+
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 186817
+
** pmwatmxoqqznbx-dkbzllmosa-j
* centisome-position:
+
* molecular-weight:
** 38.431328   
+
** 845.604
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2-MEBUCOA-FAD-RXN]]
== Reaction(s) associated ==
+
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-14266]]
** Category: [[annotation]]
+
* [[TIGLYLCOA-HYDROXY-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[2-MEBUCOA-FAD-RXN]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
{{#set: transcription-direction=negative}}
+
* [[RXN-14266]]
{{#set: right-end-position=196004}}
+
* [[TIGLYLCOA-HYDROXY-RXN]]
{{#set: left-end-position=186817}}
+
== Reaction(s) of unknown directionality ==
{{#set: centisome-position=38.431328    }}
+
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
{{#set: nb reaction associated=1}}
+
{{#set: molecular-weight=845.604}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-1083

  • common-name:
    • (e)-2-methylcrotonoyl-coa
  • smiles:
    • cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • pmwatmxoqqznbx-dkbzllmosa-j
  • molecular-weight:
    • 845.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality