Difference between revisions of "CPD-1083"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01054 == * transcription-direction: ** positive * right-end-position: ** 152338 * left-end-position: ** 141635 * centisome-position: ** 89.80325...")
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01054 ==
+
== Metabolite CPD-1083 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (e)-2-methylcrotonoyl-coa
−
* right-end-position:
+
* smiles:
−
** 152338
+
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 141635
+
** pmwatmxoqqznbx-dkbzllmosa-j
−
* centisome-position:
+
* molecular-weight:
−
** 89.80325   
+
** 845.604
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2-MEBUCOA-FAD-RXN]]
−
== Reaction(s) associated ==
+
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
−
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[RXN-14266]]
−
** Category: [[annotation]]
+
* [[TIGLYLCOA-HYDROXY-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[2-MEBUCOA-FAD-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
−
== Pathway(s) associated ==
+
* [[RXN-14266]]
−
* [[PWY-6707]]
+
* [[TIGLYLCOA-HYDROXY-RXN]]
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6163]]
+
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
−
** '''6''' reactions found over '''5''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
−
* [[QUINATEDEG-PWY]]
+
{{#set: molecular-weight=845.604}}
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6416]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=152338}}
 
−
{{#set: left-end-position=141635}}
 
−
{{#set: centisome-position=89.80325    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-1083

  • common-name:
    • (e)-2-methylcrotonoyl-coa
  • smiles:
    • cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • pmwatmxoqqznbx-dkbzllmosa-j
  • molecular-weight:
    • 845.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1083&oldid=137685"