Difference between revisions of "CPD-1083"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01054 == * transcription-direction: ** positive * right-end-position: ** 152338 * left-end-position: ** 141635 * centisome-position: ** 89.80325...")
(Created page with "Category:metabolite == Metabolite TREHALOSE == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o * inchi-key: ** hdt...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01054 ==
+
== Metabolite TREHALOSE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** α,α-trehalose
−
* right-end-position:
+
* smiles:
−
** 152338
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
−
* left-end-position:
+
* inchi-key:
−
** 141635
+
** hdtrylnuvzcqoy-lizsdcnhsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 89.80325   
+
** 342.299
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[TREHALA-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[TREHALOSEPHOSPHA-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=α,α-trehalose}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=342.299}}
−
== Pathway(s) associated ==
 
−
* [[PWY-6707]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6163]]
 
−
** '''6''' reactions found over '''5''' reactions in the full pathway
 
−
* [[QUINATEDEG-PWY]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6416]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=152338}}
 
−
{{#set: left-end-position=141635}}
 
−
{{#set: centisome-position=89.80325    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:32, 18 December 2020

Metabolite TREHALOSE

  • common-name:
    • α,α-trehalose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
  • inchi-key:
    • hdtrylnuvzcqoy-lizsdcnhsa-n
  • molecular-weight:
    • 342.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1083&oldid=46501"