Difference between revisions of "CPD-1084"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12120 == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite CPD-1084 == * common-name: ** perillyl aldehyde == Reaction(s) known to consume the compound == * RXN-14280 == Reaction(s) known to p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12120 ==
+
== Metabolite CPD-1084 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-11
+
** perillyl aldehyde
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 
* inchi-key:
 
** wvrzwraihitkpi-sokmhqjssa-n
 
* molecular-weight:
 
** 909.472
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9362]]
+
* [[RXN-14280]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-11}}
+
{{#set: common-name=perillyl aldehyde}}
{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
 
{{#set: molecular-weight=909.472}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-1084

  • common-name:
    • perillyl aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality