Difference between revisions of "CPD-1084"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite SORBITOL == * common-name: ** d-sorbitol * smiles: ** c(c(c(c(c(co)o)o)o)o)o * inchi-key: ** fbpfztcfmrresa-jgwlitmvsa-n * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SORBITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-sorbitol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c(c(c(c(co)o)o)o)o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fbpfztcfmrresa-jgwlitmvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.173 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7644]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7644]] |
| − | * [[ | + | * [[SBTD_D2]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-sorbitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fbpfztcfmrresa-jgwlitmvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.173}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite SORBITOL
- common-name:
- d-sorbitol
- smiles:
- c(c(c(c(c(co)o)o)o)o)o
- inchi-key:
- fbpfztcfmrresa-jgwlitmvsa-n
- molecular-weight:
- 182.173
