Difference between revisions of "CPD-1086"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MOHMT MOHMT] == * direction: ** reversible * common-name: ** 3-methyl-2-oxobutanoate hydroxymethylt...") |
(Created page with "Category:metabolite == Metabolite CPD-1086 == * common-name: ** 5-amino-6-(5-phospho-d-ribitylamino)uracil * smiles: ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-1086 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 5-amino-6-(5-phospho-d-ribitylamino)uracil |
− | == | + | * smiles: |
− | + | ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-] | |
− | + | * inchi-key: | |
− | * | + | ** rqrinyisxyazkl-rpdrrwsusa-l |
− | ** | + | * molecular-weight: |
− | ** | + | ** 354.213 |
− | == | + | == Reaction(s) known to consume the compound == |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RIBOFLAVINSYNREDUC-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-amino-6-(5-phospho-d-ribitylamino)uracil}} | |
− | {{#set: common-name= | + | {{#set: inchi-key=inchikey=rqrinyisxyazkl-rpdrrwsusa-l}} |
− | {{#set: | + | {{#set: molecular-weight=354.213}} |
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-1086
- common-name:
- 5-amino-6-(5-phospho-d-ribitylamino)uracil
- smiles:
- c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- rqrinyisxyazkl-rpdrrwsusa-l
- molecular-weight:
- 354.213