Difference between revisions of "CPD-1086"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...") |
(Created page with "Category:metabolite == Metabolite CPD-14950 == * common-name: ** 3-o-methylkaempferol * smiles: ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) * inchi-key: ** v...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14950 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-o-methylkaempferol |
* smiles: | * smiles: | ||
| − | ** | + | ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vjjzjbucdwkplc-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 300.267 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13935]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-o-methylkaempferol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vjjzjbucdwkplc-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=300.267}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-14950
- common-name:
- 3-o-methylkaempferol
- smiles:
- coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3))
- inchi-key:
- vjjzjbucdwkplc-uhfffaoysa-n
- molecular-weight:
- 300.267
