Difference between revisions of "CPD-1086"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] == * direction: ** reversible * common-name: ** inosine phosphoryl...")
(Created page with "Category:metabolite == Metabolite CPD-1086 == * common-name: ** 5-amino-6-(5-phospho-d-ribitylamino)uracil * smiles: ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] ==
+
== Metabolite CPD-1086 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** inosine phosphorylase
+
** 5-amino-6-(5-phospho-d-ribitylamino)uracil
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.2.1 ec-2.4.2.1]
+
** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[INOSINE]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[HYPOXANTHINE]][c] '''+''' 1 [[RIBOSE-1P]][c]
+
** rqrinyisxyazkl-rpdrrwsusa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03195]]
+
** 354.213
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RIBOFLAVINSYNREDUC-RXN]]
−
* [[SALVADEHYPOX-PWY]], adenosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY]
+
== Reaction(s) of unknown directionality ==
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=5-amino-6-(5-phospho-d-ribitylamino)uracil}}
−
* [[PWY0-1296]], purine ribonucleosides degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1296 PWY0-1296]
+
{{#set: inchi-key=inchikey=rqrinyisxyazkl-rpdrrwsusa-l}}
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
{{#set: molecular-weight=354.213}}
−
* [[PWY-6609]], adenine and adenosine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6609 PWY-6609]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27649 27649]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01863 R01863]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=inosine phosphorylase}}
 
−
{{#set: ec-number=ec-2.4.2.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-1086

  • common-name:
    • 5-amino-6-(5-phospho-d-ribitylamino)uracil
  • smiles:
    • c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • rqrinyisxyazkl-rpdrrwsusa-l
  • molecular-weight:
    • 354.213

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1086&oldid=139070"