Difference between revisions of "CPD-1091"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) * inchi-key: ** omymrcxojjzyke-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-1091 == * common-name: ** (s)-ureidoglycolate * smiles: ** c(o)(c([o-])=o)nc(n)=o * inchi-key: ** nwzyycviokvtii-sfowxeaesa-m * molec...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-1091 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-ureidoglycolate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)(c([o-])=o)nc(n)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nwzyycviokvtii-sfowxeaesa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 133.083 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ALLANTOICASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-ureidoglycolate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nwzyycviokvtii-sfowxeaesa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=133.083}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-1091
- common-name:
- (s)-ureidoglycolate
- smiles:
- c(o)(c([o-])=o)nc(n)=o
- inchi-key:
- nwzyycviokvtii-sfowxeaesa-m
- molecular-weight:
- 133.083
