Difference between revisions of "CPD-1091"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCYLGLYCINE == * common-name: ** glycyl-glycine * smiles: ** c([n+])c(=o)ncc([o-])=o * inchi-key: ** ymawopbaydpsla-uhfffaoysa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) * inchi-key: ** omymrcxojjzyke-uhfff...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12014 == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-hydroxymelatonin |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** omymrcxojjzyke-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 248.281 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11058]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11056]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-hydroxymelatonin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=omymrcxojjzyke-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=248.281}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-12014
- common-name:
- 6-hydroxymelatonin
- smiles:
- cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
- inchi-key:
- omymrcxojjzyke-uhfffaoysa-n
- molecular-weight:
- 248.281