Difference between revisions of "CPD-1099"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09599 == * transcription-direction: ** negative * right-end-position: ** 22386 * left-end-position: ** 1702 * centisome-position: ** 4.377122 =...") |
(Created page with "Category:metabolite == Metabolite CPD-1099 == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) * inchi-key...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-1099 == |
− | * | + | * common-name: |
− | ** | + | ** raffinose |
− | * | + | * smiles: |
− | ** | + | ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) |
− | * | + | * inchi-key: |
− | ** | + | ** mupfekgtmrgplj-zqskzdjdsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 504.441 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[2.4.1.67-RXN]] | |
− | == Reaction(s) | + | * [[RXN-11502]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[2.4.1.67-RXN]] |
− | + | * [[2.4.1.82-RXN]] | |
− | == | + | * [[RXN-11501]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=raffinose}} | |
− | * [[ | + | {{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}} |
− | + | {{#set: molecular-weight=504.441}} | |
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-1099
- common-name:
- raffinose
- smiles:
- c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
- inchi-key:
- mupfekgtmrgplj-zqskzdjdsa-n
- molecular-weight:
- 504.441