Difference between revisions of "CPD-1099"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N1-METHYLADENINE == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1(c(n=cn=1)=c(n)2)) * inchi-key: ** hpzmwtnatzpbih-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite CPD-1099 == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) * inchi-key...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1099 == |
* common-name: | * common-name: | ||
| − | ** | + | ** raffinose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mupfekgtmrgplj-zqskzdjdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 504.441 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.67-RXN]] |
| + | * [[RXN-11502]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.67-RXN]] | ||
| + | * [[2.4.1.82-RXN]] | ||
| + | * [[RXN-11501]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=raffinose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=504.441}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-1099
- common-name:
- raffinose
- smiles:
- c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
- inchi-key:
- mupfekgtmrgplj-zqskzdjdsa-n
- molecular-weight:
- 504.441
