Difference between revisions of "CPD-1099"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10445 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite CPD-1099 == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) * inchi-key...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-1099 == |
− | + | * common-name: | |
− | * | + | ** raffinose |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) |
− | * | + | * inchi-key: |
− | + | ** mupfekgtmrgplj-zqskzdjdsa-n | |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 504.441 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.4.1.67-RXN]] |
− | + | * [[RXN-11502]] | |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[2.4.1.67-RXN]] |
− | {{#set: | + | * [[2.4.1.82-RXN]] |
+ | * [[RXN-11501]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=raffinose}} | ||
+ | {{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}} | ||
+ | {{#set: molecular-weight=504.441}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-1099
- common-name:
- raffinose
- smiles:
- c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
- inchi-key:
- mupfekgtmrgplj-zqskzdjdsa-n
- molecular-weight:
- 504.441