Difference between revisions of "CPD-110"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROT-CYS == * common-name: ** a [protein]-l-cysteine == Reaction(s) known to consume the compound == * 1.11.1.15-RXN * 2.1.1.63-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * molecular-we...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-110 == |
* common-name: | * common-name: | ||
− | ** | + | ** salicylate |
+ | * smiles: | ||
+ | ** c(c1(=cc=cc=c1o))([o-])=o | ||
+ | * inchi-key: | ||
+ | ** ygsdefsmjlzeoe-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 137.115 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[SALICYLATE-1-MONOOXYGENASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXNQT-4366]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=salicylate}} |
+ | {{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=137.115}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-110
- common-name:
- salicylate
- smiles:
- c(c1(=cc=cc=c1o))([o-])=o
- inchi-key:
- ygsdefsmjlzeoe-uhfffaoysa-m
- molecular-weight:
- 137.115