Difference between revisions of "CPD-11020"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite CPD-11020 == * common-name: ** 5-chloro-4-hydroxy-2-oxopentanoate * smiles: ** c(=o)([o-])c(=o)cc(o)ccl * inchi-key: ** fhwphvigzzaxiq-vk...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15676 ==
+
== Metabolite CPD-11020 ==
 
* common-name:
 
* common-name:
** 6-trans-3-oxo-tridecenoyl-coa
+
** 5-chloro-4-hydroxy-2-oxopentanoate
 
* smiles:
 
* smiles:
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])c(=o)cc(o)ccl
 
* inchi-key:
 
* inchi-key:
** fdxhxlpclxeysu-hmxwsvnbsa-j
+
** fhwphvigzzaxiq-vkhmyheasa-m
 
* molecular-weight:
 
* molecular-weight:
** 971.802
+
** 165.553
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14788]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11717]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=5-chloro-4-hydroxy-2-oxopentanoate}}
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}}
+
{{#set: inchi-key=inchikey=fhwphvigzzaxiq-vkhmyheasa-m}}
{{#set: molecular-weight=971.802}}
+
{{#set: molecular-weight=165.553}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11020

  • common-name:
    • 5-chloro-4-hydroxy-2-oxopentanoate
  • smiles:
    • c(=o)([o-])c(=o)cc(o)ccl
  • inchi-key:
    • fhwphvigzzaxiq-vkhmyheasa-m
  • molecular-weight:
    • 165.553

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality