Difference between revisions of "CPD-11020"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MELIBIOSE == * common-name: ** melibiose * smiles: ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o * inchi-key: ** dlrvvldznnycbx-zzfzym...") |
(Created page with "Category:metabolite == Metabolite ARG-tRNAs == * common-name: ** a trnaarg == Reaction(s) known to consume the compound == * ARGININE--TRNA-LIGASE-RXN == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ARG-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trnaarg |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARGININE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARGINYLTRANSFERASE-RXN]] | ||
| + | * [[RXN-17888]] | ||
| + | * [[RXN-17889]] | ||
| + | * [[RXN-17890]] | ||
| + | * [[RXN-17891]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnaarg}} |
| − | |||
| − | |||
Revision as of 14:53, 5 January 2021
Contents
Metabolite ARG-tRNAs
- common-name:
- a trnaarg
