Difference between revisions of "CPD-1107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite STRICTOSIDINE == * common-name: ** 3-α(s)-strictosidine * smiles: ** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=...")
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite STRICTOSIDINE ==
+
== Metabolite CPD-1107 ==
 
* common-name:
 
* common-name:
** 3-α(s)-strictosidine
+
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
 
* smiles:
 
* smiles:
** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co))
+
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** xbamjztxgwptrm-awtfmmiesa-o
+
** ctpqaxvnygzuaj-kxxvrosksa-d
 
* molecular-weight:
 
* molecular-weight:
** 531.581
+
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10963]]
 +
* [[RXN-13197]]
 +
* [[RXN-7163]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
* [[2.7.1.134-RXN]]
 +
* [[2.7.1.140-RXN]]
 +
* [[RXN-10963]]
 +
* [[RXN-13197]]
 +
* [[RXN-7162]]
 +
* [[RXN-7184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-α(s)-strictosidine}}
+
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
{{#set: inchi-key=inchikey=xbamjztxgwptrm-awtfmmiesa-o}}
+
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
{{#set: molecular-weight=531.581}}
+
{{#set: molecular-weight=569.977}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-1107

  • common-name:
    • d-myo-inositol 1,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-kxxvrosksa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality