Difference between revisions of "CPD-1107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00218 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 6.3.2.25-RXN ** Catego...")
 
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00218 ==
+
== Metabolite CPD-1107 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
== Reaction(s) associated ==
+
* smiles:
* [[6.3.2.25-RXN]]
+
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** ctpqaxvnygzuaj-kxxvrosksa-d
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 569.977
 +
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10963]]
 +
* [[RXN-13197]]
 +
* [[RXN-7163]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.7.1.134-RXN]]
 +
* [[2.7.1.140-RXN]]
 +
* [[RXN-10963]]
 +
* [[RXN-13197]]
 +
* [[RXN-7162]]
 +
* [[RXN-7184]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
 +
{{#set: molecular-weight=569.977}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-1107

  • common-name:
    • d-myo-inositol 1,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-kxxvrosksa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality