Difference between revisions of "CPD-1107"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00218 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 6.3.2.25-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-1107 == |
− | == | + | * common-name: |
− | * [[ | + | ** d-myo-inositol 1,3,4,5,6-pentakisphosphate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) |
− | ** | + | * inchi-key: |
− | * | + | ** ctpqaxvnygzuaj-kxxvrosksa-d |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 569.977 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10963]] | ||
+ | * [[RXN-13197]] | ||
+ | * [[RXN-7163]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[2.7.1.134-RXN]] | ||
+ | * [[2.7.1.140-RXN]] | ||
+ | * [[RXN-10963]] | ||
+ | * [[RXN-13197]] | ||
+ | * [[RXN-7162]] | ||
+ | * [[RXN-7184]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}} | ||
+ | {{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}} | ||
+ | {{#set: molecular-weight=569.977}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-1107
- common-name:
- d-myo-inositol 1,3,4,5,6-pentakisphosphate
- smiles:
- c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- ctpqaxvnygzuaj-kxxvrosksa-d
- molecular-weight:
- 569.977