Difference between revisions of "CPD-1107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11571 == * transcription-direction: ** positive * right-end-position: ** 96943 * left-end-position: ** 85424 * centisome-position: ** 23.055538...")
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11571 ==
+
== Metabolite CPD-8347 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-18:2-2-lysophosphatidylcholine
−
* right-end-position:
+
* smiles:
−
** 96943
+
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
−
* left-end-position:
+
* inchi-key:
−
** 85424
+
** spjfyyjxnpezdw-ftjopakqsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 23.055538   
+
** 519.657
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-12430]]
−
* [[PANTETHEINE-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
−
* [[PANTOTHENATE-KIN-RXN]]
+
{{#set: molecular-weight=519.657}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-3961]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PANTO-PWY]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[COA-PWY-1]]
 
−
** '''2''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=96943}}
 
−
{{#set: left-end-position=85424}}
 
−
{{#set: centisome-position=23.055538    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-8347

  • common-name:
    • 1-18:2-2-lysophosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • spjfyyjxnpezdw-ftjopakqsa-n
  • molecular-weight:
    • 519.657

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1107&oldid=46644"