Difference between revisions of "CPD-1107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...")
(Created page with "Category:metabolite == Metabolite 2-KETO-3-METHYL-VALERATE == * common-name: ** (s)-3-methyl-2-oxopentanoate * smiles: ** ccc(c)c(=o)c([o-])=o * inchi-key: ** jvqyswduaoah...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8347 ==
+
== Metabolite 2-KETO-3-METHYL-VALERATE ==
 
* common-name:
 
* common-name:
** 1-18:2-2-lysophosphatidylcholine
+
** (s)-3-methyl-2-oxopentanoate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** ccc(c)c(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** spjfyyjxnpezdw-ftjopakqsa-n
+
** jvqyswduaoahfm-bypyzucnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 519.657
+
** 129.135
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[METHYLVALERATE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12430]]
+
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
 +
* [[METHYLVALERATE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
+
{{#set: common-name=(s)-3-methyl-2-oxopentanoate}}
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
+
{{#set: inchi-key=inchikey=jvqyswduaoahfm-bypyzucnsa-m}}
{{#set: molecular-weight=519.657}}
+
{{#set: molecular-weight=129.135}}

Revision as of 14:56, 5 January 2021

Metabolite 2-KETO-3-METHYL-VALERATE

  • common-name:
    • (s)-3-methyl-2-oxopentanoate
  • smiles:
    • ccc(c)c(=o)c([o-])=o
  • inchi-key:
    • jvqyswduaoahfm-bypyzucnsa-m
  • molecular-weight:
    • 129.135

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality