Difference between revisions of "CPD-1108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
(Created page with "Category:metabolite == Metabolite CPD-1108 == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 4-phosphate == Reaction(s) known to consume the compound == * 2.7.1.68-R...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-1108 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 1-phosphatidyl-1d-myo-inositol 4-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.1.68-RXN]] |
− | * [[RXN- | + | * [[RXN-13334]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]] |
− | * [[RXN- | + | * [[PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN]] |
+ | * [[RXN-10947]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 4-phosphate}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-1108
- common-name:
- a 1-phosphatidyl-1d-myo-inositol 4-phosphate