Difference between revisions of "CPD-1108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12673 == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c(o)c(o)c(o)ccl * inchi-key: ** ijqsocfskcenow-bxxzvta...") |
(Created page with "Category:metabolite == Metabolite Sphingoid-1-phosphates == * common-name: ** a sphingoid 1-phosphate == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Sphingoid-1-phosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a sphingoid 1-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11376]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a sphingoid 1-phosphate}} |
| − | |||
| − | |||
Revision as of 13:08, 14 January 2021
Contents
Metabolite Sphingoid-1-phosphates
- common-name:
- a sphingoid 1-phosphate
