Difference between revisions of "CPD-1113"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-381 == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o)[o-] * inchi-key: ** hwxbtnavrsuojr-vkhmyheasa-l *...") |
(Created page with "Category:metabolite == Metabolite L-methionyl-L-alanyl-Protein == * common-name: ** an n-terminal-l-methionyl-l-alanyl-[protein] == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-methionyl-L-alanyl-Protein == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal-l-methionyl-l-alanyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-17873]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal-l-methionyl-l-alanyl-[protein]}} |
| − | |||
| − | |||
Revision as of 18:55, 14 January 2021
Contents
Metabolite L-methionyl-L-alanyl-Protein
- common-name:
- an n-terminal-l-methionyl-l-alanyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal-l-methionyl-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
