Difference between revisions of "CPD-1121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite T2-C4-DECADIENYL-COA == * common-name: ** trans-δ2, cis-δ4-decadienoyl-coa * smiles: ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)...")
(Created page with "Category:metabolite == Metabolite Adenine-37-tRNA-Alas == * common-name: ** an adenine37 in trnaala == Reaction(s) known to consume the compound == * RXN-13996 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite T2-C4-DECADIENYL-COA ==
+
== Metabolite Adenine-37-tRNA-Alas ==
 
* common-name:
 
* common-name:
** trans-δ2, cis-δ4-decadienoyl-coa
+
** an adenine37 in trnaala
* smiles:
 
** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** fasakylwsrdqoh-imvfqkdnsa-j
 
* molecular-weight:
 
** 913.722
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIENOYLCOAREDUCT-RXN]]
+
* [[RXN-13996]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13996]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}}
+
{{#set: common-name=an adenine37 in trnaala}}
{{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}}
 
{{#set: molecular-weight=913.722}}
 

Revision as of 08:29, 15 March 2021

Metabolite Adenine-37-tRNA-Alas

  • common-name:
    • an adenine37 in trnaala

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality