Difference between revisions of "CPD-1121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Adenine-37-tRNA-Alas == * common-name: ** an adenine37 in trnaala == Reaction(s) known to consume the compound == * RXN-13996 == Reac...")
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Adenine-37-tRNA-Alas ==
+
== Metabolite CPD-1121 ==
 
* common-name:
 
* common-name:
** an adenine37 in trnaala
+
** d-myo-inositol 1,2-cyclic phosphate
 +
* smiles:
 +
** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2))
 +
* inchi-key:
 +
** sxhmvnxroauurw-ftyoscrssa-m
 +
* molecular-weight:
 +
** 241.114
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13996]]
+
* [[3.1.4.10-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13996]]
+
* [[3.1.4.10-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adenine37 in trnaala}}
+
{{#set: common-name=d-myo-inositol 1,2-cyclic phosphate}}
 +
{{#set: inchi-key=inchikey=sxhmvnxroauurw-ftyoscrssa-m}}
 +
{{#set: molecular-weight=241.114}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-1121

  • common-name:
    • d-myo-inositol 1,2-cyclic phosphate
  • smiles:
    • c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2))
  • inchi-key:
    • sxhmvnxroauurw-ftyoscrssa-m
  • molecular-weight:
    • 241.114

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality