Difference between revisions of "CPD-1121"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9545 RXN-9545] == * direction: ** left-to-right * common-name: ** 3-hydroxystearoyl-dehydratase...") |
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-1121 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol 1,2-cyclic phosphate |
− | + | * smiles: | |
− | * | + | ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) |
− | ** [ | + | * inchi-key: |
− | = | + | ** sxhmvnxroauurw-ftyoscrssa-m |
− | + | * molecular-weight: | |
− | + | ** 241.114 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[3.1.4.10-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[3.1.4.10-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=d-myo-inositol 1,2-cyclic phosphate}} |
− | == | + | {{#set: inchi-key=inchikey=sxhmvnxroauurw-ftyoscrssa-m}} |
− | * [[ | + | {{#set: molecular-weight=241.114}} |
− | |||
− | |||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-1121
- common-name:
- d-myo-inositol 1,2-cyclic phosphate
- smiles:
- c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2))
- inchi-key:
- sxhmvnxroauurw-ftyoscrssa-m
- molecular-weight:
- 241.114