Difference between revisions of "CPD-1121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9545 RXN-9545] == * direction: ** left-to-right * common-name: ** 3-hydroxystearoyl-dehydratase...")
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9545 RXN-9545] ==
+
== Metabolite CPD-1121 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-hydroxystearoyl-dehydratase
+
** d-myo-inositol 1,2-cyclic phosphate
−
** 3-hydroxyacyl-coa dehydrase
+
* smiles:
−
* ec-number:
+
** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2))
−
** [http://enzyme.expasy.org/EC/4.2.1.119 ec-4.2.1.119]
+
* inchi-key:
−
== Reaction formula ==
+
** sxhmvnxroauurw-ftyoscrssa-m
−
* 1 [[CPD-10261]][c] '''=>''' 1 [[CPD-10262]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 241.114
−
* Gene: [[SJ03584]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[3.1.4.10-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ04769]]
+
* [[3.1.4.10-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=d-myo-inositol 1,2-cyclic phosphate}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=sxhmvnxroauurw-ftyoscrssa-m}}
−
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
+
{{#set: molecular-weight=241.114}}
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07760 R07760]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-hydroxystearoyl-dehydratase|3-hydroxyacyl-coa dehydrase}}
 
−
{{#set: ec-number=ec-4.2.1.119}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-1121

  • common-name:
    • d-myo-inositol 1,2-cyclic phosphate
  • smiles:
    • c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2))
  • inchi-key:
    • sxhmvnxroauurw-ftyoscrssa-m
  • molecular-weight:
    • 241.114

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1121&oldid=138920"