Difference between revisions of "CPD-1121"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Apo-EntB == * common-name: ** an apo-[entb isochorismatase/aryl-carrier protein] == Reaction(s) known to consume the compound == * ENTD...") |
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-1121 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol 1,2-cyclic phosphate |
+ | * smiles: | ||
+ | ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) | ||
+ | * inchi-key: | ||
+ | ** sxhmvnxroauurw-ftyoscrssa-m | ||
+ | * molecular-weight: | ||
+ | ** 241.114 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.1.4.10-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.1.4.10-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol 1,2-cyclic phosphate}} |
+ | {{#set: inchi-key=inchikey=sxhmvnxroauurw-ftyoscrssa-m}} | ||
+ | {{#set: molecular-weight=241.114}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-1121
- common-name:
- d-myo-inositol 1,2-cyclic phosphate
- smiles:
- c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2))
- inchi-key:
- sxhmvnxroauurw-ftyoscrssa-m
- molecular-weight:
- 241.114