Difference between revisions of "CPD-1121"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HYPOTAURINE == * common-name: ** hypotaurine * smiles: ** c([n+])cs([o-])=o * inchi-key: ** vviubcnyacgllv-uhfffaoysa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OROTIDINE-5-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** orotidine 5'-phosphate |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kyobshfobaofbf-xvfcmesisa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 365.17 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[OROPRIBTRANS-RXN]] | ||
| + | * [[OROTPDECARB-RXN]] | ||
| + | * [[ORPDC]] | ||
| + | * [[ORPRT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[OROPRIBTRANS-RXN]] |
| + | * [[ORPRT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=orotidine 5'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=365.17}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite OROTIDINE-5-PHOSPHATE
- common-name:
- orotidine 5'-phosphate
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
- inchi-key:
- kyobshfobaofbf-xvfcmesisa-k
- molecular-weight:
- 365.17
