Difference between revisions of "CPD-11241"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-pi-phospho-L-histidines == * common-name: ** a [protein]-nπ-phospho-l-histidine == Reaction(s) known to consume the compound =...")
(Created page with "Category:metabolite == Metabolite CPD-11241 == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate * smiles: ** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-pi-phospho-L-histidines ==
+
== Metabolite CPD-11241 ==
 
* common-name:
 
* common-name:
** a [protein]-nπ-phospho-l-histidine
+
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
 +
* smiles:
 +
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
 +
* inchi-key:
 +
** llvvmxfnkahvez-gawnparcsa-l
 +
* molecular-weight:
 +
** 350.235
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15509]]
 
* [[RXN-15510]]
 
* [[RXN-15511]]
 
* [[RXN-15512]]
 
* [[RXN-17131]]
 
* [[RXN-17276]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15509]]
+
* [[RXN-14897]]
* [[RXN-15510]]
 
* [[RXN-15511]]
 
* [[RXN-15512]]
 
* [[RXN-17274]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-nπ-phospho-l-histidine}}
+
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
 +
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
 +
{{#set: molecular-weight=350.235}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-11241

  • common-name:
    • 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
  • smiles:
    • c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
  • inchi-key:
    • llvvmxfnkahvez-gawnparcsa-l
  • molecular-weight:
    • 350.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality