Difference between revisions of "CPD-11241"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07248 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...")
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07248 ==
+
== Metabolite GLC-1-P ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** α-d-glucopyranose 1-phosphate
== Reaction(s) associated ==
+
* smiles:
* [[4.2.2.10-RXN]]
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** hxxfsfrbohsimq-vfuothlcsa-l
* [[RXN-14897]]
+
* molecular-weight:
** Category: [[orthology]]
+
** 258.121
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to consume the compound ==
== Pathway(s) associated ==
+
* [[GALACTURIDYLYLTRANS-RXN]]
* [[PWY-7243]]
+
* [[GLUC1PURIDYLTRANS-RXN]]
** '''1''' reactions found over '''n.a''' reactions in the full pathway
+
* [[PGCM]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[PGMTh]]
{{#set: nb reaction associated=2}}
+
* [[PHOSPHOGLUCMUT-RXN]]
{{#set: nb pathway associated=1}}
+
* [[RXN-12486]]
 +
* [[RXN-16997]]
 +
* [[RXN4FS-13]]
 +
* [[UG1PUT]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GLYCOPHOSPHORYL-RXN]]
 +
* [[GLYMALTOPHOSPHORYL-RXN]]
 +
* [[PGCM]]
 +
* [[PGMTh]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
* [[RXN-12171]]
 +
* [[RXN-12392]]
 +
* [[RXN-12486]]
 +
* [[RXN-14284]]
 +
* [[RXN-14285]]
 +
* [[RXN-14286]]
 +
* [[RXN-14353]]
 +
* [[RXN-1826]]
 +
* [[RXN-9025]]
 +
* [[RXN0-5182]]
 +
* [[RXN0-5184]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
 +
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 20:33, 18 December 2020

Metabolite GLC-1-P

  • common-name:
    • α-d-glucopyranose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-vfuothlcsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality