Difference between revisions of "CPD-11281"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21571 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PItm ** Category: or...") |
(Created page with "Category:metabolite == Metabolite CPD-11281 == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** qbolvl...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11281 == |
| − | + | * common-name: | |
| − | * | + | ** s-sulfanylglutathione |
| − | + | * smiles: | |
| − | + | ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | |
| − | + | * inchi-key: | |
| − | ** | + | ** qbolvlbsugjhgb-wdskdsinsa-m |
| − | * | + | * molecular-weight: |
| − | + | ** 338.373 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | + | * [[FESGSHTHIO-RXN]] | |
| − | * | + | * [[RXN-13161]] |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | ** | + | {{#set: common-name=s-sulfanylglutathione}} |
| − | + | {{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}} | |
| − | * | + | {{#set: molecular-weight=338.373}} |
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-11281
- common-name:
- s-sulfanylglutathione
- smiles:
- c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- qbolvlbsugjhgb-wdskdsinsa-m
- molecular-weight:
- 338.373
