Difference between revisions of "CPD-1130"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04970 == * transcription-direction: ** negative * right-end-position: ** 442527 * left-end-position: ** 425133 * centisome-position: ** 44.02631...") |
(Created page with "Category:metabolite == Metabolite CPD-1130 == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o * inchi-key: ** jucrenbzzqkfgk-uhfffaoysa-l * molecu...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-1130 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-ethylmalate |
| − | * | + | * smiles: |
| − | ** | + | ** ccc(c([o-])=o)c(c(=o)[o-])o |
| − | * | + | * inchi-key: |
| − | ** | + | ** jucrenbzzqkfgk-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 160.126 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14986]] |
| − | == Reaction(s) | + | * [[RXN-18210]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-18210]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-ethylmalate}} | |
| − | + | {{#set: inchi-key=inchikey=jucrenbzzqkfgk-uhfffaoysa-l}} | |
| − | + | {{#set: molecular-weight=160.126}} | |
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-1130
- common-name:
- 3-ethylmalate
- smiles:
- ccc(c([o-])=o)c(c(=o)[o-])o
- inchi-key:
- jucrenbzzqkfgk-uhfffaoysa-l
- molecular-weight:
- 160.126
