Difference between revisions of "CPD-1130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18761 == * common-name: ** coniferyl alcohol radical * smiles: ** coc1(=cc(=ccco)c=cc(=o)1) * inchi-key: ** orajwsykrgvtdp-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite CPD-10332 == * common-name: ** gibberellin44 (open lactone form) * smiles: ** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18761 ==
+
== Metabolite CPD-10332 ==
 
* common-name:
 
* common-name:
** coniferyl alcohol radical
+
** gibberellin44 (open lactone form)
 
* smiles:
 
* smiles:
** coc1(=cc(=ccco)c=cc(=o)1)
+
** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** orajwsykrgvtdp-uhfffaoysa-n
+
** axeuuxhmkspqai-ytjhipewsa-l
 
* molecular-weight:
 
* molecular-weight:
** 179.195
+
** 362.422
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1F-168]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17351]]
+
* [[RXN1F-167]]
* [[RXN-17352]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferyl alcohol radical}}
+
{{#set: common-name=gibberellin44 (open lactone form)}}
{{#set: inchi-key=inchikey=orajwsykrgvtdp-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=axeuuxhmkspqai-ytjhipewsa-l}}
{{#set: molecular-weight=179.195}}
+
{{#set: molecular-weight=362.422}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-10332

  • common-name:
    • gibberellin44 (open lactone form)
  • smiles:
    • c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • axeuuxhmkspqai-ytjhipewsa-l
  • molecular-weight:
    • 362.422

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality