Difference between revisions of "CPD-11398"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19488 == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11398 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-thyroxine phenolic β-d-glucuronide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghrjbikiyuhev-sgpdefqssa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 951.992 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10606]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-thyroxine phenolic β-d-glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=951.992}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11398
- common-name:
- l-thyroxine phenolic β-d-glucuronide
- smiles:
- c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
- inchi-key:
- rghrjbikiyuhev-sgpdefqssa-m
- molecular-weight:
- 951.992
